7-Hydroxymitragynine (inactive)
|
7-Hydroxymitragynine
Mitragynine (Kratom) metabolite 7-OH |
|
| methyl (E)-2-[(2S,3S,7aS,12bS)-3-ethyl-7a-hydroxy-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-2-yl]-3-methoxyprop-2-enoate | |
| Plant-based substances | |
| Synthetic opioids |
|
| 174418-82-7 | |
|
|
InChI=1S/C23H30N2O5/c1-5-14-12-25-10-9-23(27)20-17(7-6-8-19(20)29-3)24-21(23)18(25)11-15(14)16(13-28-2)22(26)30-4/h6-8,13-15,18,27H,5,9-12H2,1-4H3/b16-13+/t14-,15+,18+,23+/m1/s1
|
|
RYENLSMHLCNXJT-CYXFISRXSA-N
|
|
|
CC[C@@H]1CN2CC[C@]3(C(=NC4=C3C(=CC=C4)OC)[C@@H]2C[C@@H]1/C(=C\OC)/C(=O)OC)O
|
|
| C23H30N2O5 | |
| 414.4947 g/mol | |
|
7-hydroxymitragynine is generally not present in fresh kratom leaves but forms during the drying process; it is also formed by oxidation of mitragynine by hepatic and intestinal cytochromes. There is emerging evidence of products sold with 7-hydroxymitragynine as the main ingredient or mixed with mitragynine pseudoindoxyl.
Hill K, Boyer EW, Grundmann O, Smith KE. De facto opioids: Characterization of novel 7-hydroxymitragynine and mitragynine pseudoindoxyl product marketing. Drug Alcohol Depend. 2025 Jul 1;272:112701. doi: 10.1016/j.drugalcdep.2025.112701. |