Mitragynine pseudoindoxyl (inactive)
|
Mitragynine pseudoindoxyl
7-Hydroxymitragynine (Kratom) metabolite |
|
| methyl (E)-2-[(2S,6'S,7'S,8'aS)-6'-ethyl-4-methoxy-3-oxospiro[1H-indole-2,1'-3,5,6,7,8,8a-hexahydro-2H-indolizine]-7'-yl]-3-methoxyprop-2-enoate | |
| Plant-based substances | |
| Synthetic opioids |
|
| 2035457-43-1 | |
|
|
InChI=1S/C23H30N2O5/c1-5-14-12-25-10-9-23(19(25)11-15(14)16(13-28-2)22(27)30-4)21(26)20-17(24-23)7-6-8-18(20)29-3/h6-8,13-15,19,24H,5,9-12H2,1-4H3/b16-13+/t14-,15+,19+,23?/m1/s1
|
|
BAEJBRCYKACTAA-AIFWNKBHSA-N
|
|
|
CC[C@@H]1CN2CC[C@]3([C@@H]2C[C@@H]1/C(=C\OC)/C(=O)OC)C(=O)C4=C(N3)C=CC=C4OC
|
|
| C23H30N2O5 | |
| 414.4947 g/mol | |
|
7-hydroxymitragynine is metabolized to mitragynine pseudoindoxyl. There is emerging evidence of products sold with mitragynine pseudoindoxyl as the main ingredient or mixed with 7-hydroxymitragynine.
Hill K, Boyer EW, Grundmann O, Smith KE. De facto opioids: Characterization of novel 7-hydroxymitragynine and mitragynine pseudoindoxyl product marketing. Drug Alcohol Depend. 2025 Jul 1;272:112701. doi: 10.1016/j.drugalcdep.2025.112701. Epub 2025 May 8. PMID: 40373645; PMCID: PMC12138786. |